methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate

C13H24N2O4S — CID 117239605

IUPACmethyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate
SMILESCOC(=O)C(CN1CCNCC1)C1CCS(=O)(=O)CC1
InChIInChI=1S/C13H24N2O4S/c1-19-13(16)12(10-15-6-4-14-5-7-15)11-2-8-20(17,18)9-3-11/h11-12,14H,2-10H2,1H3
InChIKeyWYEMKGDCSOKQEY-UHFFFAOYSA-N
MW304.41 g/mol
LogP-0.49
Rot. Bonds4

About methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate

methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate (PubChem CID 117239605) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate.

Molecular Properties

Compound Namemethyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate
PubChem CID117239605
Molecular FormulaC13H24N2O4S
Molecular Weight304.41 g/mol
Exact Mass304.15
IUPAC Namemethyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate
SMILESCOC(=O)C(CN1CCNCC1)C1CCS(=O)(=O)CC1
InChIInChI=1S/C13H24N2O4S/c1-19-13(16)12(10-15-6-4-14-5-7-15)11-2-8-20(17,18)9-3-11/h11-12,14H,2-10H2,1H3
InChIKeyWYEMKGDCSOKQEY-UHFFFAOYSA-N
XLogP-0.49
TPSA75.71 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.41
LogP ≤ 5-0.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate?
The IUPAC name of methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate (CID 117239605) is methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate.
What is the SMILES notation for methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate?
The canonical SMILES for methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate is COC(=O)C(CN1CCNCC1)C1CCS(=O)(=O)CC1.
What is the InChIKey of methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate?
The InChIKey is WYEMKGDCSOKQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O4S/c1-19-13(16)12(10-15-6-4-14-5-7-15)11-2-8-20(17,18)9-3-11/h11-12,14H,2-10H2,1H3.
What are the key properties of methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate?
methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate has a molecular weight of 304.41 g/mol, XLogP of -0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,1-dioxothian-4-yl)-3-piperazin-1-ylpropanoate is sourced from PubChem (CID 117239605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).