C14H10ClF3N6 — CID 11725713
9-(3-chloro-4-pyridinyl)-N-cyclopropyl-2-(trifluoromethyl)purin-6-amine (PubChem CID 11725713) has the molecular formula C14H10ClF3N6 and a molecular weight of 354.72 g/mol. Its IUPAC name is 9-(3-chloro-4-pyridinyl)-N-cyclopropyl-2-(trifluoromethyl)purin-6-amine.
| Compound Name | 9-(3-chloro-4-pyridinyl)-N-cyclopropyl-2-(trifluoromethyl)purin-6-amine |
|---|---|
| PubChem CID | 11725713 |
| Molecular Formula | C14H10ClF3N6 |
| Molecular Weight | 354.72 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 9-(3-chloro-4-pyridinyl)-N-cyclopropyl-2-(trifluoromethyl)purin-6-amine |
| SMILES | FC(F)(F)c1nc(NC2CC2)c2ncn(-c3ccncc3Cl)c2n1 |
| InChI | InChI=1S/C14H10ClF3N6/c15-8-5-19-4-3-9(8)24-6-20-10-11(21-7-1-2-7)22-13(14(16,17)18)23-12(10)24/h3-7H,1-2H2,(H,21,22,23) |
| InChIKey | ZFOSGOAXYJUXER-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.72 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |