C11H15NO2S — CID 117258414
4-(thiophen-2-ylmethyl)piperidine-2-carboxylic acid (PubChem CID 117258414) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-(thiophen-2-ylmethyl)piperidine-2-carboxylic acid.
| Compound Name | 4-(thiophen-2-ylmethyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 117258414 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 4-(thiophen-2-ylmethyl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(Cc2cccs2)CCN1 |
| InChI | InChI=1S/C11H15NO2S/c13-11(14)10-7-8(3-4-12-10)6-9-2-1-5-15-9/h1-2,5,8,10,12H,3-4,6-7H2,(H,13,14) |
| InChIKey | LKFMAXDMEFNMGE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |