C13H19N — CID 117272132
2,4,4,6-tetramethyl-2,3-dihydro-1H-quinoline (PubChem CID 117272132) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2,4,4,6-tetramethyl-2,3-dihydro-1H-quinoline.
| Compound Name | 2,4,4,6-tetramethyl-2,3-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 117272132 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2,4,4,6-tetramethyl-2,3-dihydro-1H-quinoline |
| SMILES | Cc1ccc2c(c1)C(C)(C)CC(C)N2 |
| InChI | InChI=1S/C13H19N/c1-9-5-6-12-11(7-9)13(3,4)8-10(2)14-12/h5-7,10,14H,8H2,1-4H3 |
| InChIKey | DELWSLGNTVRQMI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |