C15H19BrO — CID 102036508
2-bromo-4,4,7-trimethylspiro[2,3-dihydronaphthalene-1,2'-oxetane] (PubChem CID 102036508) has the molecular formula C15H19BrO and a molecular weight of 295.22 g/mol. Its IUPAC name is 2-bromo-4,4,7-trimethylspiro[2,3-dihydronaphthalene-1,2'-oxetane].
| Compound Name | 2-bromo-4,4,7-trimethylspiro[2,3-dihydronaphthalene-1,2'-oxetane] |
|---|---|
| PubChem CID | 102036508 |
| Molecular Formula | C15H19BrO |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-bromo-4,4,7-trimethylspiro[2,3-dihydronaphthalene-1,2'-oxetane] |
| SMILES | Cc1ccc2c(c1)C1(CCO1)C(Br)CC2(C)C |
| InChI | InChI=1S/C15H19BrO/c1-10-4-5-11-12(8-10)15(6-7-17-15)13(16)9-14(11,2)3/h4-5,8,13H,6-7,9H2,1-3H3 |
| InChIKey | YARNTXKHEKCSBW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|