C11H13N3O — CID 117291729
4-[3-(dimethylamino)phenyl]-1,2-oxazol-5-amine (PubChem CID 117291729) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-[3-(dimethylamino)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 4-[3-(dimethylamino)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117291729 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-[3-(dimethylamino)phenyl]-1,2-oxazol-5-amine |
| SMILES | CN(C)c1cccc(-c2cnoc2N)c1 |
| InChI | InChI=1S/C11H13N3O/c1-14(2)9-5-3-4-8(6-9)10-7-13-15-11(10)12/h3-7H,12H2,1-2H3 |
| InChIKey | BMNAMXJBJOHJAJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |