C10H8N2O2S — CID 117314072
4-(1,3-benzoxathiol-5-yl)-1,2-oxazol-5-amine (PubChem CID 117314072) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 4-(1,3-benzoxathiol-5-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(1,3-benzoxathiol-5-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117314072 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 4-(1,3-benzoxathiol-5-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1-c1ccc2c(c1)SCO2 |
| InChI | InChI=1S/C10H8N2O2S/c11-10-7(4-12-14-10)6-1-2-8-9(3-6)15-5-13-8/h1-4H,5,11H2 |
| InChIKey | CZTXUFNOQWLACX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |