C13H11N3OS — CID 117396578
4-(2-cyclopropyl-1,3-benzothiazol-5-yl)-1,2-oxazol-5-amine (PubChem CID 117396578) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-(2-cyclopropyl-1,3-benzothiazol-5-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(2-cyclopropyl-1,3-benzothiazol-5-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117396578 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-(2-cyclopropyl-1,3-benzothiazol-5-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1-c1ccc2sc(C3CC3)nc2c1 |
| InChI | InChI=1S/C13H11N3OS/c14-12-9(6-15-17-12)8-3-4-11-10(5-8)16-13(18-11)7-1-2-7/h3-7H,1-2,14H2 |
| InChIKey | YDTXANHYJMFURG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |