C12H16N2O — CID 117292757
3-(1,3-dimethylindazol-6-yl)propan-1-ol (PubChem CID 117292757) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-(1,3-dimethylindazol-6-yl)propan-1-ol.
| Compound Name | 3-(1,3-dimethylindazol-6-yl)propan-1-ol |
|---|---|
| PubChem CID | 117292757 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-(1,3-dimethylindazol-6-yl)propan-1-ol |
| SMILES | Cc1nn(C)c2cc(CCCO)ccc12 |
| InChI | InChI=1S/C12H16N2O/c1-9-11-6-5-10(4-3-7-15)8-12(11)14(2)13-9/h5-6,8,15H,3-4,7H2,1-2H3 |
| InChIKey | GJTVBPWWYNICLX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |