C7H8ClNO4 — CID 117294298
6-(aminooxymethyl)-5-chlorobenzene-1,2,4-triol (PubChem CID 117294298) has the molecular formula C7H8ClNO4 and a molecular weight of 205.60 g/mol. Its IUPAC name is 6-(aminooxymethyl)-5-chlorobenzene-1,2,4-triol.
| Compound Name | 6-(aminooxymethyl)-5-chlorobenzene-1,2,4-triol |
|---|---|
| PubChem CID | 117294298 |
| Molecular Formula | C7H8ClNO4 |
| Molecular Weight | 205.60 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 6-(aminooxymethyl)-5-chlorobenzene-1,2,4-triol |
| SMILES | NOCc1c(O)c(O)cc(O)c1Cl |
| InChI | InChI=1S/C7H8ClNO4/c8-6-3(2-13-9)7(12)5(11)1-4(6)10/h1,10-12H,2,9H2 |
| InChIKey | OGIHCBHKLCVRHS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.60 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|