C24H29NO4S — CID 11729629
[(3S)-oct-1-yn-3-yl] (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 11729629) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is [(3S)-oct-1-yn-3-yl] (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | [(3S)-oct-1-yn-3-yl] (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11729629 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [(3S)-oct-1-yn-3-yl] (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | C#C[C@H](CCCCC)OC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H29NO4S/c1-4-6-8-13-21(5-2)29-24(26)23(18-20-11-9-7-10-12-20)25-30(27,28)22-16-14-19(3)15-17-22/h2,7,9-12,14-17,21,23,25H,4,6,8,13,18H2,1,3H3/t21-,23+/m1/s1 |
| InChIKey | KJNNVRYMRHYXEB-GGAORHGYSA-N |
| XLogP | 4.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|