C12H19NO2 — CID 117299336
2-[3-(1,2-dimethoxyethyl)phenyl]ethanamine (PubChem CID 117299336) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-[3-(1,2-dimethoxyethyl)phenyl]ethanamine.
| Compound Name | 2-[3-(1,2-dimethoxyethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 117299336 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-[3-(1,2-dimethoxyethyl)phenyl]ethanamine |
| SMILES | COCC(OC)c1cccc(CCN)c1 |
| InChI | InChI=1S/C12H19NO2/c1-14-9-12(15-2)11-5-3-4-10(8-11)6-7-13/h3-5,8,12H,6-7,9,13H2,1-2H3 |
| InChIKey | DVGNCVUVLVYFNJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |