C22H26N4O8 — CID 11730426
(2,5-dioxopyrrolidin-1-yl) 2-[[3-(3-ethoxy-2-nitro-3-oxopropyl)-1H-indol-4-yl]amino]-3-methylbutanoate (PubChem CID 11730426) has the molecular formula C22H26N4O8 and a molecular weight of 474.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[3-(3-ethoxy-2-nitro-3-oxopropyl)-1H-indol-4-yl]amino]-3-methylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[3-(3-ethoxy-2-nitro-3-oxopropyl)-1H-indol-4-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 11730426 |
| Molecular Formula | C22H26N4O8 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[3-(3-ethoxy-2-nitro-3-oxopropyl)-1H-indol-4-yl]amino]-3-methylbutanoate |
| SMILES | CCOC(=O)C(Cc1c[nH]c2cccc(NC(C(=O)ON3C(=O)CCC3=O)C(C)C)c12)[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N4O8/c1-4-33-21(29)16(26(31)32)10-13-11-23-14-6-5-7-15(19(13)14)24-20(12(2)3)22(30)34-25-17(27)8-9-18(25)28/h5-7,11-12,16,20,23-24H,4,8-10H2,1-3H3 |
| InChIKey | NWYYKBDKWBKIOY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|