C12H12ClN3O4 — CID 176628872
ethyl 3-(4-chloro-1H-pyrrolo[3,2-c]pyridin-3-yl)-2-nitropropanoate (PubChem CID 176628872) has the molecular formula C12H12ClN3O4 and a molecular weight of 297.70 g/mol. Its IUPAC name is ethyl 3-(4-chloro-1H-pyrrolo[3,2-c]pyridin-3-yl)-2-nitropropanoate.
| Compound Name | ethyl 3-(4-chloro-1H-pyrrolo[3,2-c]pyridin-3-yl)-2-nitropropanoate |
|---|---|
| PubChem CID | 176628872 |
| Molecular Formula | C12H12ClN3O4 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | ethyl 3-(4-chloro-1H-pyrrolo[3,2-c]pyridin-3-yl)-2-nitropropanoate |
| SMILES | CCOC(=O)C(Cc1c[nH]c2ccnc(Cl)c12)[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClN3O4/c1-2-20-12(17)9(16(18)19)5-7-6-15-8-3-4-14-11(13)10(7)8/h3-4,6,9,15H,2,5H2,1H3 |
| InChIKey | QZFLAWVZRRETIX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|