C10H13N3O8 — CID 175511189
(2,5-dioxopyrrolidin-1-yl) 2,5-dinitrohexanoate (PubChem CID 175511189) has the molecular formula C10H13N3O8 and a molecular weight of 303.23 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,5-dinitrohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,5-dinitrohexanoate |
|---|---|
| PubChem CID | 175511189 |
| Molecular Formula | C10H13N3O8 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,5-dinitrohexanoate |
| SMILES | CC(CCC(C(=O)ON1C(=O)CCC1=O)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O8/c1-6(12(17)18)2-3-7(13(19)20)10(16)21-11-8(14)4-5-9(11)15/h6-7H,2-5H2,1H3 |
| InChIKey | IVNVTFWDBNQUOI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|