C25H28N2O2S — CID 11732561
2-(2-acetyl-1H-indol-3-yl)-1-[(3S)-3-(2-phenylsulfanylethyl)piperidin-1-yl]ethanone (PubChem CID 11732561) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-(2-acetyl-1H-indol-3-yl)-1-[(3S)-3-(2-phenylsulfanylethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(2-acetyl-1H-indol-3-yl)-1-[(3S)-3-(2-phenylsulfanylethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 11732561 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-(2-acetyl-1H-indol-3-yl)-1-[(3S)-3-(2-phenylsulfanylethyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)c1[nH]c2ccccc2c1CC(=O)N1CCC[C@@H](CCSc2ccccc2)C1 |
| InChI | InChI=1S/C25H28N2O2S/c1-18(28)25-22(21-11-5-6-12-23(21)26-25)16-24(29)27-14-7-8-19(17-27)13-15-30-20-9-3-2-4-10-20/h2-6,9-12,19,26H,7-8,13-17H2,1H3/t19-/m0/s1 |
| InChIKey | CQAIONOFLACBCE-IBGZPJMESA-N |
| XLogP | 5.33 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|