C13H13N3O — CID 117327000
5-(2,3-dimethyl-1H-indol-7-yl)-1,2-oxazol-3-amine (PubChem CID 117327000) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 5-(2,3-dimethyl-1H-indol-7-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2,3-dimethyl-1H-indol-7-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117327000 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 5-(2,3-dimethyl-1H-indol-7-yl)-1,2-oxazol-3-amine |
| SMILES | Cc1[nH]c2c(-c3cc(N)no3)cccc2c1C |
| InChI | InChI=1S/C13H13N3O/c1-7-8(2)15-13-9(7)4-3-5-10(13)11-6-12(14)16-17-11/h3-6,15H,1-2H3,(H2,14,16) |
| InChIKey | OCPFLBBOPKTKAG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|