C16H19N3O2 — CID 29151109
5-(2,3-dimethyl-1H-indol-7-yl)-3-(2-ethoxyethyl)-1,2,4-oxadiazole (PubChem CID 29151109) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-(2,3-dimethyl-1H-indol-7-yl)-3-(2-ethoxyethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2,3-dimethyl-1H-indol-7-yl)-3-(2-ethoxyethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 29151109 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 5-(2,3-dimethyl-1H-indol-7-yl)-3-(2-ethoxyethyl)-1,2,4-oxadiazole |
| SMILES | CCOCCc1noc(-c2cccc3c(C)c(C)[nH]c23)n1 |
| InChI | InChI=1S/C16H19N3O2/c1-4-20-9-8-14-18-16(21-19-14)13-7-5-6-12-10(2)11(3)17-15(12)13/h5-7,17H,4,8-9H2,1-3H3 |
| InChIKey | IUXVRRNUTRGDSG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|