C11H12N2O4 — CID 136983498
3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]benzene-1,2-diol (PubChem CID 136983498) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]benzene-1,2-diol.
| Compound Name | 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136983498 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]benzene-1,2-diol |
| SMILES | CCOCc1noc(-c2cccc(O)c2O)n1 |
| InChI | InChI=1S/C11H12N2O4/c1-2-16-6-9-12-11(17-13-9)7-4-3-5-8(14)10(7)15/h3-5,14-15H,2,6H2,1H3 |
| InChIKey | RYWVEKWFBVTLMA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|