C12H13FN2O3 — CID 136701059
5-fluoro-2-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136701059) has the molecular formula C12H13FN2O3 and a molecular weight of 252.25 g/mol. Its IUPAC name is 5-fluoro-2-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 5-fluoro-2-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136701059 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 5-fluoro-2-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CCCOCc1noc(-c2ccc(F)cc2O)n1 |
| InChI | InChI=1S/C12H13FN2O3/c1-2-5-17-7-11-14-12(18-15-11)9-4-3-8(13)6-10(9)16/h3-4,6,16H,2,5,7H2,1H3 |
| InChIKey | WSKZUJUETRQPRS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|