C29H42O3 — CID 11732881
cyclohexen-1-ylmethyl (6E,9E,12E,15E,18E)-20-(oxiran-2-yl)icosa-6,9,12,15,18-pentaenoate (PubChem CID 11732881) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is cyclohexen-1-ylmethyl (6E,9E,12E,15E,18E)-20-(oxiran-2-yl)icosa-6,9,12,15,18-pentaenoate.
| Compound Name | cyclohexen-1-ylmethyl (6E,9E,12E,15E,18E)-20-(oxiran-2-yl)icosa-6,9,12,15,18-pentaenoate |
|---|---|
| PubChem CID | 11732881 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | cyclohexen-1-ylmethyl (6E,9E,12E,15E,18E)-20-(oxiran-2-yl)icosa-6,9,12,15,18-pentaenoate |
| SMILES | O=C(CCCC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CC1CO1)OCC1=CCCCC1 |
| InChI | InChI=1S/C29H42O3/c30-29(32-25-27-21-17-16-18-22-27)24-20-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-19-23-28-26-31-28/h2-5,8-11,14,19,21,28H,1,6-7,12-13,15-18,20,22-26H2/b4-2+,5-3+,10-8+,11-9+,19-14+ |
| InChIKey | AXQNBEJFXJLSOZ-QJADGRNXSA-N |
| XLogP | 7.72 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|