C12H17ClO2 — CID 117329674
2-(3-chloro-2-methoxy-4,6-dimethylphenyl)propan-2-ol (PubChem CID 117329674) has the molecular formula C12H17ClO2 and a molecular weight of 228.72 g/mol. Its IUPAC name is 2-(3-chloro-2-methoxy-4,6-dimethylphenyl)propan-2-ol.
| Compound Name | 2-(3-chloro-2-methoxy-4,6-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 117329674 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(3-chloro-2-methoxy-4,6-dimethylphenyl)propan-2-ol |
| SMILES | COc1c(Cl)c(C)cc(C)c1C(C)(C)O |
| InChI | InChI=1S/C12H17ClO2/c1-7-6-8(2)10(13)11(15-5)9(7)12(3,4)14/h6,14H,1-5H3 |
| InChIKey | ZKMUXWMSQYDMBB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |