C16H23N — CID 117331180
1-[(3-cyclohexylphenyl)methyl]cyclopropan-1-amine (PubChem CID 117331180) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-[(3-cyclohexylphenyl)methyl]cyclopropan-1-amine.
| Compound Name | 1-[(3-cyclohexylphenyl)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 117331180 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-[(3-cyclohexylphenyl)methyl]cyclopropan-1-amine |
| SMILES | NC1(Cc2cccc(C3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C16H23N/c17-16(9-10-16)12-13-5-4-8-15(11-13)14-6-2-1-3-7-14/h4-5,8,11,14H,1-3,6-7,9-10,12,17H2 |
| InChIKey | NKYZOXZLKGTNFU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |