C8H10N2O4S — CID 117332292
N-[(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)methyl]hydroxylamine (PubChem CID 117332292) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is N-[(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)methyl]hydroxylamine.
| Compound Name | N-[(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117332292 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | N-[(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)methyl]hydroxylamine |
| SMILES | O=S1(=O)COc2ccc(CNO)cc2N1 |
| InChI | InChI=1S/C8H10N2O4S/c11-9-4-6-1-2-8-7(3-6)10-15(12,13)5-14-8/h1-3,9-11H,4-5H2 |
| InChIKey | HACGYISQWGOGCC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|