C8H9NO2S — CID 117279627
N-(1,3-benzoxathiol-5-ylmethyl)hydroxylamine (PubChem CID 117279627) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is N-(1,3-benzoxathiol-5-ylmethyl)hydroxylamine.
| Compound Name | N-(1,3-benzoxathiol-5-ylmethyl)hydroxylamine |
|---|---|
| PubChem CID | 117279627 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | N-(1,3-benzoxathiol-5-ylmethyl)hydroxylamine |
| SMILES | ONCc1ccc2c(c1)SCO2 |
| InChI | InChI=1S/C8H9NO2S/c10-9-4-6-1-2-7-8(3-6)12-5-11-7/h1-3,9-10H,4-5H2 |
| InChIKey | WHMKKLZNOURRFR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|