C11H16N2O3S — CID 117394420
4-(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)butan-1-amine (PubChem CID 117394420) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)butan-1-amine.
| Compound Name | 4-(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)butan-1-amine |
|---|---|
| PubChem CID | 117394420 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)butan-1-amine |
| SMILES | NCCCCc1ccc2c(c1)NS(=O)(=O)CO2 |
| InChI | InChI=1S/C11H16N2O3S/c12-6-2-1-3-9-4-5-11-10(7-9)13-17(14,15)8-16-11/h4-5,7,13H,1-3,6,8,12H2 |
| InChIKey | BAKWJAGFPLLPOG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|