C9H9NO5S — CID 117359245
2-(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)acetic acid (PubChem CID 117359245) has the molecular formula C9H9NO5S and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)acetic acid.
| Compound Name | 2-(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)acetic acid |
|---|---|
| PubChem CID | 117359245 |
| Molecular Formula | C9H9NO5S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2-(2,2-dioxo-1H-4,2λ6,1-benzoxathiazin-7-yl)acetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1)NS(=O)(=O)CO2 |
| InChI | InChI=1S/C9H9NO5S/c11-9(12)4-6-1-2-8-7(3-6)10-16(13,14)5-15-8/h1-3,10H,4-5H2,(H,11,12) |
| InChIKey | SRHJPFKURTYJFA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |