C11H11NO3S — CID 117346568
6-(isocyanatomethyl)-5-methylsulfanyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 117346568) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 6-(isocyanatomethyl)-5-methylsulfanyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(isocyanatomethyl)-5-methylsulfanyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 117346568 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 6-(isocyanatomethyl)-5-methylsulfanyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CSc1c(CN=C=O)ccc2c1OCCO2 |
| InChI | InChI=1S/C11H11NO3S/c1-16-11-8(6-12-7-13)2-3-9-10(11)15-5-4-14-9/h2-3H,4-6H2,1H3 |
| InChIKey | ZZGQRQFABYFKOY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|