C35H42O4S2Si — CID 11734789
[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-tritylsulfanylpropyl] 4-methylbenzenesulfonate (PubChem CID 11734789) has the molecular formula C35H42O4S2Si and a molecular weight of 618.94 g/mol. Its IUPAC name is [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-tritylsulfanylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-tritylsulfanylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11734789 |
| Molecular Formula | C35H42O4S2Si |
| Molecular Weight | 618.94 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-tritylsulfanylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](CSC(c2ccccc2)(c2ccccc2)c2ccccc2)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H42O4S2Si/c1-28-22-24-33(25-23-28)41(36,37)38-26-32(39-42(5,6)34(2,3)4)27-40-35(29-16-10-7-11-17-29,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h7-25,32H,26-27H2,1-6H3/t32-/m0/s1 |
| InChIKey | UFNZRMDTKGFVGA-YTTGMZPUSA-N |
| XLogP | 8.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.94 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|