C11H12F3NO2 — CID 117369613
2-[1-(aminomethyl)cyclopropyl]-6-(trifluoromethyl)benzene-1,4-diol (PubChem CID 117369613) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclopropyl]-6-(trifluoromethyl)benzene-1,4-diol.
| Compound Name | 2-[1-(aminomethyl)cyclopropyl]-6-(trifluoromethyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 117369613 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-[1-(aminomethyl)cyclopropyl]-6-(trifluoromethyl)benzene-1,4-diol |
| SMILES | NCC1(c2cc(O)cc(C(F)(F)F)c2O)CC1 |
| InChI | InChI=1S/C11H12F3NO2/c12-11(13,14)8-4-6(16)3-7(9(8)17)10(5-15)1-2-10/h3-4,16-17H,1-2,5,15H2 |
| InChIKey | QRQXGHXIVCXWAB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|