C12H14F3NO2 — CID 117406720
4-[1-(aminomethyl)cyclobutyl]-5-(trifluoromethyl)benzene-1,2-diol (PubChem CID 117406720) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 4-[1-(aminomethyl)cyclobutyl]-5-(trifluoromethyl)benzene-1,2-diol.
| Compound Name | 4-[1-(aminomethyl)cyclobutyl]-5-(trifluoromethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 117406720 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-[1-(aminomethyl)cyclobutyl]-5-(trifluoromethyl)benzene-1,2-diol |
| SMILES | NCC1(c2cc(O)c(O)cc2C(F)(F)F)CCC1 |
| InChI | InChI=1S/C12H14F3NO2/c13-12(14,15)8-5-10(18)9(17)4-7(8)11(6-16)2-1-3-11/h4-5,17-18H,1-3,6,16H2 |
| InChIKey | MYTQWOOBDNRKAP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|