C12H13ClF3NO — CID 117448625
2-[1-(aminomethyl)cyclobutyl]-4-chloro-6-(trifluoromethyl)phenol (PubChem CID 117448625) has the molecular formula C12H13ClF3NO and a molecular weight of 279.69 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclobutyl]-4-chloro-6-(trifluoromethyl)phenol.
| Compound Name | 2-[1-(aminomethyl)cyclobutyl]-4-chloro-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 117448625 |
| Molecular Formula | C12H13ClF3NO |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-[1-(aminomethyl)cyclobutyl]-4-chloro-6-(trifluoromethyl)phenol |
| SMILES | NCC1(c2cc(Cl)cc(C(F)(F)F)c2O)CCC1 |
| InChI | InChI=1S/C12H13ClF3NO/c13-7-4-8(11(6-17)2-1-3-11)10(18)9(5-7)12(14,15)16/h4-5,18H,1-3,6,17H2 |
| InChIKey | JGEDADJVIFXJSX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |