C13H13NO2S — CID 117370863
1-(1,3-benzothiazol-4-yl)cyclopentane-1-carboxylic acid (PubChem CID 117370863) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-4-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(1,3-benzothiazol-4-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117370863 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1-(1,3-benzothiazol-4-yl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc3scnc23)CCCC1 |
| InChI | InChI=1S/C13H13NO2S/c15-12(16)13(6-1-2-7-13)9-4-3-5-10-11(9)14-8-17-10/h3-5,8H,1-2,6-7H2,(H,15,16) |
| InChIKey | MDHJYPSBILNWRO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |