C14H14O3S — CID 117410446
1-(4-hydroxy-1-benzothiophen-5-yl)cyclopentane-1-carboxylic acid (PubChem CID 117410446) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-(4-hydroxy-1-benzothiophen-5-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(4-hydroxy-1-benzothiophen-5-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117410446 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-(4-hydroxy-1-benzothiophen-5-yl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc3sccc3c2O)CCCC1 |
| InChI | InChI=1S/C14H14O3S/c15-12-9-5-8-18-11(9)4-3-10(12)14(13(16)17)6-1-2-7-14/h3-5,8,15H,1-2,6-7H2,(H,16,17) |
| InChIKey | FAYCTMAIDVQADT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |