About 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid
1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid (PubChem CID 82623256) has the molecular formula C11H11NO2S2
and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid.
Analyze 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid?
The IUPAC name of 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid (CID 82623256) is 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid?
The canonical SMILES for 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid is O=C(O)C1(c2nsc3ccsc23)CCCC1.
What is the InChIKey of 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid?
The InChIKey is MQUJQVMHSCYQGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S2/c13-10(14)11(4-1-2-5-11)9-8-7(16-12-9)3-6-15-8/h3,6H,1-2,4-5H2,(H,13,14).
What are the key properties of 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid?
1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid has a molecular weight of 253.35 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thieno[2,3-d][1,2]thiazol-3-ylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 82623256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).