C11H12ClN3OS — CID 11737294
[1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl] carbamimidothioate (PubChem CID 11737294) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl] carbamimidothioate.
| Compound Name | [1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl] carbamimidothioate |
|---|---|
| PubChem CID | 11737294 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | [1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SC1CCN(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C11H12ClN3OS/c12-7-2-1-3-8(6-7)15-5-4-9(10(15)16)17-11(13)14/h1-3,6,9H,4-5H2,(H3,13,14) |
| InChIKey | VTWSNAZVWNDVFV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|