C11H13BrClN3OS — CID 139075961
[amino-[(3R)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]sulfanylmethylidene]azanium bromide (PubChem CID 139075961) has the molecular formula C11H13BrClN3OS and a molecular weight of 350.67 g/mol. Its IUPAC name is [amino-[(3R)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]sulfanylmethylidene]azanium bromide.
| Compound Name | [amino-[(3R)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]sulfanylmethylidene]azanium bromide |
|---|---|
| PubChem CID | 139075961 |
| Molecular Formula | C11H13BrClN3OS |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | [amino-[(3R)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]sulfanylmethylidene]azanium bromide |
| SMILES | NC(=[NH2+])S[C@@H]1CCN(c2cccc(Cl)c2)C1=O.[Br-] |
| InChI | InChI=1S/C11H12ClN3OS.BrH/c12-7-2-1-3-8(6-7)15-5-4-9(10(15)16)17-11(13)14;/h1-3,6,9H,4-5H2,(H3,13,14);1H/t9-;/m1./s1 |
| InChIKey | RUIVRURHALHQBK-SBSPUUFOSA-N |
| XLogP | -2.74 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|