C19H28O3 — CID 11738264
(2R)-2-[(1R,2S,6R,7R,9R,12S)-4,12-dimethyl-11-oxo-10-oxatricyclo[7.3.1.02,7]tridec-3-en-6-yl]-3-methylbutanal (PubChem CID 11738264) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2R)-2-[(1R,2S,6R,7R,9R,12S)-4,12-dimethyl-11-oxo-10-oxatricyclo[7.3.1.02,7]tridec-3-en-6-yl]-3-methylbutanal.
| Compound Name | (2R)-2-[(1R,2S,6R,7R,9R,12S)-4,12-dimethyl-11-oxo-10-oxatricyclo[7.3.1.02,7]tridec-3-en-6-yl]-3-methylbutanal |
|---|---|
| PubChem CID | 11738264 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2R)-2-[(1R,2S,6R,7R,9R,12S)-4,12-dimethyl-11-oxo-10-oxatricyclo[7.3.1.02,7]tridec-3-en-6-yl]-3-methylbutanal |
| SMILES | CC1=C[C@@H]2[C@H]3C[C@@H](C[C@@H]2[C@H]([C@H](C=O)C(C)C)C1)OC(=O)[C@H]3C |
| InChI | InChI=1S/C19H28O3/c1-10(2)18(9-20)16-6-11(3)5-15-14-7-13(8-17(15)16)22-19(21)12(14)4/h5,9-10,12-18H,6-8H2,1-4H3/t12-,13-,14-,15+,16+,17-,18+/m0/s1 |
| InChIKey | BWAUAQUOJFILKB-FPMLTQPBSA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|