C16H20N2O — CID 117394556
8-piperidin-2-yl-1,3,4,5-tetrahydropyrano[4,3-b]indole (PubChem CID 117394556) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 8-piperidin-2-yl-1,3,4,5-tetrahydropyrano[4,3-b]indole.
| Compound Name | 8-piperidin-2-yl-1,3,4,5-tetrahydropyrano[4,3-b]indole |
|---|---|
| PubChem CID | 117394556 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 8-piperidin-2-yl-1,3,4,5-tetrahydropyrano[4,3-b]indole |
| SMILES | c1cc2[nH]c3c(c2cc1C1CCCCN1)COCC3 |
| InChI | InChI=1S/C16H20N2O/c1-2-7-17-14(3-1)11-4-5-15-12(9-11)13-10-19-8-6-16(13)18-15/h4-5,9,14,17-18H,1-3,6-8,10H2 |
| InChIKey | BRQMAAXHPUHTOX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|