C15H18N2O — CID 117358131
8-pyrrolidin-2-yl-1,3,4,5-tetrahydropyrano[4,3-b]indole (PubChem CID 117358131) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 8-pyrrolidin-2-yl-1,3,4,5-tetrahydropyrano[4,3-b]indole.
| Compound Name | 8-pyrrolidin-2-yl-1,3,4,5-tetrahydropyrano[4,3-b]indole |
|---|---|
| PubChem CID | 117358131 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 8-pyrrolidin-2-yl-1,3,4,5-tetrahydropyrano[4,3-b]indole |
| SMILES | c1cc2[nH]c3c(c2cc1C1CCCN1)COCC3 |
| InChI | InChI=1S/C15H18N2O/c1-2-13(16-6-1)10-3-4-14-11(8-10)12-9-18-7-5-15(12)17-14/h3-4,8,13,16-17H,1-2,5-7,9H2 |
| InChIKey | NFZCLUVETRJRMP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|