C15H18N2O2 — CID 117399428
4-amino-4-(1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)butanoic acid (PubChem CID 117399428) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-amino-4-(1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)butanoic acid.
| Compound Name | 4-amino-4-(1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)butanoic acid |
|---|---|
| PubChem CID | 117399428 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4-amino-4-(1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)butanoic acid |
| SMILES | NC(CCC(=O)O)c1ccc2[nH]c3c(c2c1)CCC3 |
| InChI | InChI=1S/C15H18N2O2/c16-12(5-7-15(18)19)9-4-6-14-11(8-9)10-2-1-3-13(10)17-14/h4,6,8,12,17H,1-3,5,7,16H2,(H,18,19) |
| InChIKey | GLZXZGDUORYNJZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|