C17H21NO3S — CID 170822928
S-[2,3-dihydroxy-3-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)propyl] ethanethioate (PubChem CID 170822928) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822928 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | S-[2,3-dihydroxy-3-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C17H21NO3S/c1-10(19)22-9-16(20)17(21)11-6-7-15-13(8-11)12-4-2-3-5-14(12)18-15/h6-8,16-18,20-21H,2-5,9H2,1H3 |
| InChIKey | TWULVRBGKWDHJY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|