C18H19N3O6 — CID 11740058
diethyl 2-(2-benzoylhydrazinyl)-6-oxo-1H-pyridine-3,5-dicarboxylate (PubChem CID 11740058) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is diethyl 2-(2-benzoylhydrazinyl)-6-oxo-1H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-(2-benzoylhydrazinyl)-6-oxo-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11740058 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | diethyl 2-(2-benzoylhydrazinyl)-6-oxo-1H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c(=O)[nH]c1NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O6/c1-3-26-17(24)12-10-13(18(25)27-4-2)16(23)19-14(12)20-21-15(22)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | VQASBKZLGJKGHA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|