C13H13ClN2O2 — CID 117416149
4-[3-chloro-4-(2-methylprop-2-enoxy)phenyl]-1,2-oxazol-5-amine (PubChem CID 117416149) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 4-[3-chloro-4-(2-methylprop-2-enoxy)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 4-[3-chloro-4-(2-methylprop-2-enoxy)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117416149 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-[3-chloro-4-(2-methylprop-2-enoxy)phenyl]-1,2-oxazol-5-amine |
| SMILES | C=C(C)COc1ccc(-c2cnoc2N)cc1Cl |
| InChI | InChI=1S/C13H13ClN2O2/c1-8(2)7-17-12-4-3-9(5-11(12)14)10-6-16-18-13(10)15/h3-6H,1,7,15H2,2H3 |
| InChIKey | HWCLDCYDWXQLGH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|