C15H16ClNO2 — CID 117445302
1-(4-chloro-1-methylindol-6-yl)cyclopentane-1-carboxylic acid (PubChem CID 117445302) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 1-(4-chloro-1-methylindol-6-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(4-chloro-1-methylindol-6-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117445302 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(4-chloro-1-methylindol-6-yl)cyclopentane-1-carboxylic acid |
| SMILES | Cn1ccc2c(Cl)cc(C3(C(=O)O)CCCC3)cc21 |
| InChI | InChI=1S/C15H16ClNO2/c1-17-7-4-11-12(16)8-10(9-13(11)17)15(14(18)19)5-2-3-6-15/h4,7-9H,2-3,5-6H2,1H3,(H,18,19) |
| InChIKey | ODJFHLGRELFUFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |