C13H15O2Y- — CID 58954909
1-(3-methylbenzene-4-id-1-yl)cyclopentane-1-carboxylic acid;yttrium (PubChem CID 58954909) has the molecular formula C13H15O2Y- and a molecular weight of 292.17 g/mol. Its IUPAC name is 1-(3-methylbenzene-4-id-1-yl)cyclopentane-1-carboxylic acid;yttrium.
| Compound Name | 1-(3-methylbenzene-4-id-1-yl)cyclopentane-1-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 58954909 |
| Molecular Formula | C13H15O2Y- |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-(3-methylbenzene-4-id-1-yl)cyclopentane-1-carboxylic acid;yttrium |
| SMILES | Cc1[c-]ccc(C2(C(=O)O)CCCC2)c1.[Y] |
| InChI | InChI=1S/C13H15O2.Y/c1-10-5-4-6-11(9-10)13(12(14)15)7-2-3-8-13;/h4,6,9H,2-3,7-8H2,1H3,(H,14,15);/q-1; |
| InChIKey | AQSZTMUMEHVXOG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|