C14H15ClN2O2 — CID 117447014
5-(5-chloro-2-methyl-1H-indol-6-yl)pyrrolidine-3-carboxylic acid (PubChem CID 117447014) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 5-(5-chloro-2-methyl-1H-indol-6-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(5-chloro-2-methyl-1H-indol-6-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117447014 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-(5-chloro-2-methyl-1H-indol-6-yl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc2cc(Cl)c(C3CC(C(=O)O)CN3)cc2[nH]1 |
| InChI | InChI=1S/C14H15ClN2O2/c1-7-2-8-3-11(15)10(5-12(8)17-7)13-4-9(6-16-13)14(18)19/h2-3,5,9,13,16-17H,4,6H2,1H3,(H,18,19) |
| InChIKey | PZHDXOBKZBBNSR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |