About (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate
(3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate (PubChem CID 11745732) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate.
Molecular Properties
| Compound Name | (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate |
| PubChem CID | 11745732 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate |
| SMILES | CC(=O)OCC1CC(C)(C)N(O)CO1 |
| InChI | InChI=1S/C9H17NO4/c1-7(11)13-5-8-4-9(2,3)10(12)6-14-8/h8,12H,4-6H2,1-3H3 |
| InChIKey | OGLBXJSAWGAJAN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate?
The IUPAC name of (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate (CID 11745732) is (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate.
What is the SMILES notation for (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate?
The canonical SMILES for (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate is CC(=O)OCC1CC(C)(C)N(O)CO1.
What is the InChIKey of (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate?
The InChIKey is OGLBXJSAWGAJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-7(11)13-5-8-4-9(2,3)10(12)6-14-8/h8,12H,4-6H2,1-3H3.
What are the key properties of (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate?
(3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate has a molecular weight of 203.24 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate is sourced from PubChem (CID 11745732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).