About (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate
(3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate (PubChem CID 11745732) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate.
Analyze (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate?
The IUPAC name of (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate (CID 11745732) is (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate.
What is the SMILES notation for (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate?
The canonical SMILES for (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate is CC(=O)OCC1CC(C)(C)N(O)CO1.
What is the InChIKey of (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate?
The InChIKey is OGLBXJSAWGAJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-7(11)13-5-8-4-9(2,3)10(12)6-14-8/h8,12H,4-6H2,1-3H3.
What are the key properties of (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate?
(3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate has a molecular weight of 203.24 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-4,4-dimethyl-1,3-oxazinan-6-yl)methyl acetate is sourced from PubChem (CID 11745732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).