C12H16ClNO3S — CID 117468030
3-(3-chloro-4-methoxy-5-methylsulfonylphenyl)pyrrolidine (PubChem CID 117468030) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxy-5-methylsulfonylphenyl)pyrrolidine.
| Compound Name | 3-(3-chloro-4-methoxy-5-methylsulfonylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 117468030 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 3-(3-chloro-4-methoxy-5-methylsulfonylphenyl)pyrrolidine |
| SMILES | COc1c(Cl)cc(C2CCNC2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C12H16ClNO3S/c1-17-12-10(13)5-9(8-3-4-14-7-8)6-11(12)18(2,15)16/h5-6,8,14H,3-4,7H2,1-2H3 |
| InChIKey | LAHBKJBMWUDAFB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |