C11H13ClF2OSi — CID 11747440
[1-(4-chlorophenyl)-2,2-difluoroethenoxy]-trimethylsilane (PubChem CID 11747440) has the molecular formula C11H13ClF2OSi and a molecular weight of 262.76 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2,2-difluoroethenoxy]-trimethylsilane.
| Compound Name | [1-(4-chlorophenyl)-2,2-difluoroethenoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11747440 |
| Molecular Formula | C11H13ClF2OSi |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | [1-(4-chlorophenyl)-2,2-difluoroethenoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(=C(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClF2OSi/c1-16(2,3)15-10(11(13)14)8-4-6-9(12)7-5-8/h4-7H,1-3H3 |
| InChIKey | LHHMQACBKUEMDZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|